C10H22NO2- — CID 163968768
N-(2,6-dimethylheptan-4-yloxy)-N-oxidomethanamine (PubChem CID 163968768) has the molecular formula C10H22NO2- and a molecular weight of 188.29 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-yloxy)-N-oxidomethanamine.
| Compound Name | N-(2,6-dimethylheptan-4-yloxy)-N-oxidomethanamine |
|---|---|
| PubChem CID | 163968768 |
| Molecular Formula | C10H22NO2- |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | N-(2,6-dimethylheptan-4-yloxy)-N-oxidomethanamine |
| SMILES | CC(C)CC(CC(C)C)ON(C)[O-] |
| InChI | InChI=1S/C10H22NO2/c1-8(2)6-10(7-9(3)4)13-11(5)12/h8-10H,6-7H2,1-5H3/q-1 |
| InChIKey | XLQSGQRLPNFQHB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|