C36H72N4O6 — CID 54417903
2,6-dimethylheptan-4-yl N-[2-[bis[2-(2,6-dimethylheptan-4-yloxycarbonylamino)ethyl]amino]ethyl]carbamate (PubChem CID 54417903) has the molecular formula C36H72N4O6 and a molecular weight of 656.99 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-yl N-[2-[bis[2-(2,6-dimethylheptan-4-yloxycarbonylamino)ethyl]amino]ethyl]carbamate.
| Compound Name | 2,6-dimethylheptan-4-yl N-[2-[bis[2-(2,6-dimethylheptan-4-yloxycarbonylamino)ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 54417903 |
| Molecular Formula | C36H72N4O6 |
| Molecular Weight | 656.99 g/mol |
| Exact Mass | 656.55 |
| IUPAC Name | 2,6-dimethylheptan-4-yl N-[2-[bis[2-(2,6-dimethylheptan-4-yloxycarbonylamino)ethyl]amino]ethyl]carbamate |
| SMILES | CC(C)CC(CC(C)C)OC(=O)NCCN(CCNC(=O)OC(CC(C)C)CC(C)C)CCNC(=O)OC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C36H72N4O6/c1-25(2)19-31(20-26(3)4)44-34(41)37-13-16-40(17-14-38-35(42)45-32(21-27(5)6)22-28(7)8)18-15-39-36(43)46-33(23-29(9)10)24-30(11)12/h25-33H,13-24H2,1-12H3,(H,37,41)(H,38,42)(H,39,43) |
| InChIKey | VYSOYUXPYHWZJB-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.99 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|