C30H21F2N3O5 — CID 58371583
6-[[2-(cyclopropylcarbamoyl)-6-fluoro-3H-inden-5-yl]methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid (PubChem CID 58371583) has the molecular formula C30H21F2N3O5 and a molecular weight of 541.51 g/mol. Its IUPAC name is 6-[[2-(cyclopropylcarbamoyl)-6-fluoro-3H-inden-5-yl]methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid.
| Compound Name | 6-[[2-(cyclopropylcarbamoyl)-6-fluoro-3H-inden-5-yl]methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 58371583 |
| Molecular Formula | C30H21F2N3O5 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 6-[[2-(cyclopropylcarbamoyl)-6-fluoro-3H-inden-5-yl]methyl]-4-fluoro-8-(2-oxo-1H-pyridin-3-yl)furo[2,3-e]indole-7-carboxylic acid |
| SMILES | O=C(NC1CC1)C1=Cc2cc(F)c(Cn3c(C(=O)O)c(-c4ccc[nH]c4=O)c4c5occc5c(F)cc43)cc2C1 |
| InChI | InChI=1S/C30H21F2N3O5/c31-21-11-15-9-16(28(36)34-18-3-4-18)8-14(15)10-17(21)13-35-23-12-22(32)19-5-7-40-27(19)25(23)24(26(35)30(38)39)20-2-1-6-33-29(20)37/h1-2,5-7,9-12,18H,3-4,8,13H2,(H,33,37)(H,34,36)(H,38,39) |
| InChIKey | XCBIIFWCFWYQKS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |