C22H25ClF3NO2 — CID 58374481
3-[[5-[(2S)-2-(4-chloro-3,5-dimethylphenyl)-3,3,3-trifluoropropyl]-2-methylphenyl]methylamino]propanoic acid (PubChem CID 58374481) has the molecular formula C22H25ClF3NO2 and a molecular weight of 427.89 g/mol. Its IUPAC name is 3-[[5-[(2S)-2-(4-chloro-3,5-dimethylphenyl)-3,3,3-trifluoropropyl]-2-methylphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[5-[(2S)-2-(4-chloro-3,5-dimethylphenyl)-3,3,3-trifluoropropyl]-2-methylphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 58374481 |
| Molecular Formula | C22H25ClF3NO2 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-[[5-[(2S)-2-(4-chloro-3,5-dimethylphenyl)-3,3,3-trifluoropropyl]-2-methylphenyl]methylamino]propanoic acid |
| SMILES | Cc1ccc(C[C@@H](c2cc(C)c(Cl)c(C)c2)C(F)(F)F)cc1CNCCC(=O)O |
| InChI | InChI=1S/C22H25ClF3NO2/c1-13-4-5-16(10-18(13)12-27-7-6-20(28)29)11-19(22(24,25)26)17-8-14(2)21(23)15(3)9-17/h4-5,8-10,19,27H,6-7,11-12H2,1-3H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | QERHHCIJUZIFAM-IBGZPJMESA-N |
| XLogP | 5.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|