C20H26ClNO2 — CID 58374530
5-[(2S)-2-(4-chloro-3-methylphenyl)butyl]-3-(dimethoxymethyl)-2-methylpyridine (PubChem CID 58374530) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 5-[(2S)-2-(4-chloro-3-methylphenyl)butyl]-3-(dimethoxymethyl)-2-methylpyridine.
| Compound Name | 5-[(2S)-2-(4-chloro-3-methylphenyl)butyl]-3-(dimethoxymethyl)-2-methylpyridine |
|---|---|
| PubChem CID | 58374530 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-[(2S)-2-(4-chloro-3-methylphenyl)butyl]-3-(dimethoxymethyl)-2-methylpyridine |
| SMILES | CC[C@@H](Cc1cnc(C)c(C(OC)OC)c1)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C20H26ClNO2/c1-6-16(17-7-8-19(21)13(2)9-17)10-15-11-18(14(3)22-12-15)20(23-4)24-5/h7-9,11-12,16,20H,6,10H2,1-5H3/t16-/m0/s1 |
| InChIKey | UFLFVXWRIOQQCH-INIZCTEOSA-N |
| XLogP | 5.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|