C18H22Cl2N2O2 — CID 67345901
5-chloro-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-(dimethoxymethyl)pyridin-2-amine (PubChem CID 67345901) has the molecular formula C18H22Cl2N2O2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-(dimethoxymethyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-(dimethoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 67345901 |
| Molecular Formula | C18H22Cl2N2O2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-chloro-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-(dimethoxymethyl)pyridin-2-amine |
| SMILES | CC[C@@H](Nc1cc(C(OC)OC)c(Cl)cn1)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C18H22Cl2N2O2/c1-5-16(12-6-7-14(19)11(2)8-12)22-17-9-13(15(20)10-21-17)18(23-3)24-4/h6-10,16,18H,5H2,1-4H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | GAWRKNPQQVNDOH-MRXNPFEDSA-N |
| XLogP | 5.55 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|