C28H31Cl2N3O — CID 58378293
4-(dibenzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one (PubChem CID 58378293) has the molecular formula C28H31Cl2N3O and a molecular weight of 496.48 g/mol. Its IUPAC name is 4-(dibenzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one.
| Compound Name | 4-(dibenzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 58378293 |
| Molecular Formula | C28H31Cl2N3O |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 4-(dibenzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
| SMILES | O=C(CCCN(Cc1ccccc1)Cc1ccccc1)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C28H31Cl2N3O/c29-25-18-31-19-26(30)28(25)33-16-13-24(14-17-33)27(34)12-7-15-32(20-22-8-3-1-4-9-22)21-23-10-5-2-6-11-23/h1-6,8-11,18-19,24H,7,12-17,20-21H2 |
| InChIKey | UHXTUTXNTCPRNR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |