C21H25Cl2N3O — CID 58378298
4-(benzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one (PubChem CID 58378298) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 4-(benzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one.
| Compound Name | 4-(benzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 58378298 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-(benzylamino)-1-[1-(3,5-dichloro-4-pyridinyl)piperidin-4-yl]butan-1-one |
| SMILES | O=C(CCCNCc1ccccc1)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O/c22-18-14-25-15-19(23)21(18)26-11-8-17(9-12-26)20(27)7-4-10-24-13-16-5-2-1-3-6-16/h1-3,5-6,14-15,17,24H,4,7-13H2 |
| InChIKey | KWILCDUZURERKY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|