C20H24ClN3O — CID 58378301
4-amino-1-[1-(3-chloro-5-phenyl-4-pyridinyl)piperidin-4-yl]butan-1-one (PubChem CID 58378301) has the molecular formula C20H24ClN3O and a molecular weight of 357.88 g/mol. Its IUPAC name is 4-amino-1-[1-(3-chloro-5-phenyl-4-pyridinyl)piperidin-4-yl]butan-1-one.
| Compound Name | 4-amino-1-[1-(3-chloro-5-phenyl-4-pyridinyl)piperidin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 58378301 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-amino-1-[1-(3-chloro-5-phenyl-4-pyridinyl)piperidin-4-yl]butan-1-one |
| SMILES | NCCCC(=O)C1CCN(c2c(Cl)cncc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24ClN3O/c21-18-14-23-13-17(15-5-2-1-3-6-15)20(18)24-11-8-16(9-12-24)19(25)7-4-10-22/h1-3,5-6,13-14,16H,4,7-12,22H2 |
| InChIKey | QGOKWWHALJNKNY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |