C14H28O2 — CID 58381850
2-[2,4-diethyl-3-(2-hydroxyethyl)cyclohexyl]ethanol (PubChem CID 58381850) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[2,4-diethyl-3-(2-hydroxyethyl)cyclohexyl]ethanol.
| Compound Name | 2-[2,4-diethyl-3-(2-hydroxyethyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 58381850 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-[2,4-diethyl-3-(2-hydroxyethyl)cyclohexyl]ethanol |
| SMILES | CCC1CCC(CCO)C(CC)C1CCO |
| InChI | InChI=1S/C14H28O2/c1-3-11-5-6-12(7-9-15)13(4-2)14(11)8-10-16/h11-16H,3-10H2,1-2H3 |
| InChIKey | DSJIIEBQDFFKIP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |