C20H16F3N5O — CID 58382034
4-(5-methoxy-1-methylindol-3-yl)-12-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58382034) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is 4-(5-methoxy-1-methylindol-3-yl)-12-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 4-(5-methoxy-1-methylindol-3-yl)-12-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58382034 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-(5-methoxy-1-methylindol-3-yl)-12-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc2c(c1)c(-c1cc3c(ncc4cnc(CC(F)(F)F)n43)[nH]1)cn2C |
| InChI | InChI=1S/C20H16F3N5O/c1-27-10-14(13-5-12(29-2)3-4-16(13)27)15-6-17-19(26-15)25-9-11-8-24-18(28(11)17)7-20(21,22)23/h3-6,8-10,26H,7H2,1-2H3 |
| InChIKey | PQLWSNJCOKERPL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |