C33H40F4O2 — CID 58383261
8-fluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]-7-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromen-2-one (PubChem CID 58383261) has the molecular formula C33H40F4O2 and a molecular weight of 544.67 g/mol. Its IUPAC name is 8-fluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]-7-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromen-2-one.
| Compound Name | 8-fluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]-7-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 58383261 |
| Molecular Formula | C33H40F4O2 |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 8-fluoro-3-[4-(4-pentylcyclohexyl)cyclohexyl]-7-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromen-2-one |
| SMILES | CCCCCC1CCC(C2CCC(C3Cc4ccc(-c5ccc(C(F)(F)F)cc5)c(F)c4OC3=O)CC2)CC1 |
| InChI | InChI=1S/C33H40F4O2/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-25(13-11-23)29-20-26-16-19-28(30(34)31(26)39-32(29)38)24-14-17-27(18-15-24)33(35,36)37/h14-19,21-23,25,29H,2-13,20H2,1H3 |
| InChIKey | ZUCPXFIZFAGPJL-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|