C30H29NO5 — CID 58384167
N-benzyl-N-[[4-methoxy-3-[[4-(2-oxopropyl)phenoxy]methyl]phenyl]methyl]furan-2-carboxamide (PubChem CID 58384167) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is N-benzyl-N-[[4-methoxy-3-[[4-(2-oxopropyl)phenoxy]methyl]phenyl]methyl]furan-2-carboxamide.
| Compound Name | N-benzyl-N-[[4-methoxy-3-[[4-(2-oxopropyl)phenoxy]methyl]phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 58384167 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-benzyl-N-[[4-methoxy-3-[[4-(2-oxopropyl)phenoxy]methyl]phenyl]methyl]furan-2-carboxamide |
| SMILES | COc1ccc(CN(Cc2ccccc2)C(=O)c2ccco2)cc1COc1ccc(CC(C)=O)cc1 |
| InChI | InChI=1S/C30H29NO5/c1-22(32)17-23-10-13-27(14-11-23)36-21-26-18-25(12-15-28(26)34-2)20-31(19-24-7-4-3-5-8-24)30(33)29-9-6-16-35-29/h3-16,18H,17,19-21H2,1-2H3 |
| InChIKey | GPBJUFABGINLFL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |