C25H32FN3O3 — CID 58384275
(2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide (PubChem CID 58384275) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 58384275 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](C)NC)C(=O)N1C[C@@H](F)C[C@H]1C(=O)C[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C25H32FN3O3/c1-4-8-21(28-24(31)16(2)27-3)25(32)29-15-19(26)14-22(29)23(30)13-18-11-7-10-17-9-5-6-12-20(17)18/h1,5-6,9,12,16,18-19,21-22,27H,7-8,10-11,13-15H2,2-3H3,(H,28,31)/t16-,18-,19-,21-,22-/m0/s1 |
| InChIKey | QVOAWEYTEMCFIA-ITJSPEIASA-N |
| XLogP | 2.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|