C27H34FN3O2 — CID 58386772
3-[4-(4-cyclohexylpiperazin-1-yl)butyl]-6-(4-fluorophenyl)-1,3-benzoxazol-2-one (PubChem CID 58386772) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is 3-[4-(4-cyclohexylpiperazin-1-yl)butyl]-6-(4-fluorophenyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-[4-(4-cyclohexylpiperazin-1-yl)butyl]-6-(4-fluorophenyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 58386772 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3-[4-(4-cyclohexylpiperazin-1-yl)butyl]-6-(4-fluorophenyl)-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2cc(-c3ccc(F)cc3)ccc2n1CCCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C27H34FN3O2/c28-23-11-8-21(9-12-23)22-10-13-25-26(20-22)33-27(32)31(25)15-5-4-14-29-16-18-30(19-17-29)24-6-2-1-3-7-24/h8-13,20,24H,1-7,14-19H2 |
| InChIKey | GFDGWFVQYILWLP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 41.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|