C25H25N3O3 — CID 58386943
4-[3-(cyclohexen-1-yl)-4-[2-(5-ethynyl-1H-imidazol-2-yl)-2-oxoethyl]phenyl]-1-methylpiperidine-2,6-dione (PubChem CID 58386943) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[3-(cyclohexen-1-yl)-4-[2-(5-ethynyl-1H-imidazol-2-yl)-2-oxoethyl]phenyl]-1-methylpiperidine-2,6-dione.
| Compound Name | 4-[3-(cyclohexen-1-yl)-4-[2-(5-ethynyl-1H-imidazol-2-yl)-2-oxoethyl]phenyl]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 58386943 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 4-[3-(cyclohexen-1-yl)-4-[2-(5-ethynyl-1H-imidazol-2-yl)-2-oxoethyl]phenyl]-1-methylpiperidine-2,6-dione |
| SMILES | C#Cc1cnc(C(=O)Cc2ccc(C3CC(=O)N(C)C(=O)C3)cc2C2=CCCCC2)[nH]1 |
| InChI | InChI=1S/C25H25N3O3/c1-3-20-15-26-25(27-20)22(29)12-18-10-9-17(11-21(18)16-7-5-4-6-8-16)19-13-23(30)28(2)24(31)14-19/h1,7,9-11,15,19H,4-6,8,12-14H2,2H3,(H,26,27) |
| InChIKey | DKTVVXNKTSGLMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|