C25H26N4O3 — CID 58386971
2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile (PubChem CID 58386971) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile.
| Compound Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile |
|---|---|
| PubChem CID | 58386971 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1H-imidazole-5-carbonitrile |
| SMILES | CC1(C)CC=C(c2cc(C3CC(=O)NC(=O)C3)ccc2CC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C25H26N4O3/c1-25(2)7-5-15(6-8-25)20-9-16(18-11-22(31)29-23(32)12-18)3-4-17(20)10-21(30)24-27-14-19(13-26)28-24/h3-5,9,14,18H,6-8,10-12H2,1-2H3,(H,27,28)(H,29,31,32) |
| InChIKey | PXXTYSDZLJXJKG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|