C31H40N4O4Si — CID 58387020
2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58387020) has the molecular formula C31H40N4O4Si and a molecular weight of 560.77 g/mol. Its IUPAC name is 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58387020 |
| Molecular Formula | C31H40N4O4Si |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[2-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2,6-dioxopiperidin-4-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | CC1(C)CC=C(c2cc(C3CC(=O)NC(=O)C3)ccc2CC(=O)c2nc(C#N)cn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C31H40N4O4Si/c1-31(2)10-8-21(9-11-31)26-14-22(24-16-28(37)34-29(38)17-24)6-7-23(26)15-27(36)30-33-25(18-32)19-35(30)20-39-12-13-40(3,4)5/h6-8,14,19,24H,9-13,15-17,20H2,1-5H3,(H,34,37,38) |
| InChIKey | ARZWGDNICHDWKU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|