C33H46N4O4Si — CID 148905535
2-[2-[2-(cyclohexen-1-yl)-4-[1-(4-hydroxybutanoyl)piperidin-4-yl]phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 148905535) has the molecular formula C33H46N4O4Si and a molecular weight of 590.84 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-[1-(4-hydroxybutanoyl)piperidin-4-yl]phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-[1-(4-hydroxybutanoyl)piperidin-4-yl]phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 148905535 |
| Molecular Formula | C33H46N4O4Si |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-[1-(4-hydroxybutanoyl)piperidin-4-yl]phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C2CCN(C(=O)CCCO)CC2)cc1C1=CCCCC1 |
| InChI | InChI=1S/C33H46N4O4Si/c1-42(2,3)19-18-41-24-37-23-29(22-34)35-33(37)31(39)21-28-12-11-27(20-30(28)26-8-5-4-6-9-26)25-13-15-36(16-14-25)32(40)10-7-17-38/h8,11-12,20,23,25,38H,4-7,9-10,13-19,21,24H2,1-3H3 |
| InChIKey | PHPPMXQWTWKLRC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|