C31H43N5O3Si — CID 58386997
2-[2-[2-(cyclohepten-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386997) has the molecular formula C31H43N5O3Si and a molecular weight of 561.80 g/mol. Its IUPAC name is 2-[2-[2-(cyclohepten-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohepten-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386997 |
| Molecular Formula | C31H43N5O3Si |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 2-[2-[2-(cyclohepten-1-yl)-4-(1,3-dimethyl-2-oxo-1,3-diazinan-5-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | CN1CC(c2ccc(CC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCCCCC3)c2)CN(C)C1=O |
| InChI | InChI=1S/C31H43N5O3Si/c1-34-19-26(20-35(2)31(34)38)24-12-13-25(28(16-24)23-10-8-6-7-9-11-23)17-29(37)30-33-27(18-32)21-36(30)22-39-14-15-40(3,4)5/h10,12-13,16,21,26H,6-9,11,14-15,17,19-20,22H2,1-5H3 |
| InChIKey | BZCQKPFRFMKDEV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 91.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|