C33H47N5O4Si — CID 162690456
tert-butyl 2-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 162690456) has the molecular formula C33H47N5O4Si and a molecular weight of 605.86 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 162690456 |
| Molecular Formula | C33H47N5O4Si |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | tert-butyl 2-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1ccc(NC(=O)c2nc(C#N)cn2COCC[Si](C)(C)C)c(C2=CCCCC2)c1 |
| InChI | InChI=1S/C33H47N5O4Si/c1-33(2,3)42-32(40)38-17-11-10-14-29(38)25-15-16-28(27(20-25)24-12-8-7-9-13-24)36-31(39)30-35-26(21-34)22-37(30)23-41-18-19-43(4,5)6/h12,15-16,20,22,29H,7-11,13-14,17-19,23H2,1-6H3,(H,36,39) |
| InChIKey | FQTBRUBLJGDYLZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|