C32H45N5O4SSi — CID 123602301
tert-butyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(3,6-dihydro-2H-thiopyran-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 123602301) has the molecular formula C32H45N5O4SSi and a molecular weight of 623.90 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(3,6-dihydro-2H-thiopyran-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(3,6-dihydro-2H-thiopyran-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123602301 |
| Molecular Formula | C32H45N5O4SSi |
| Molecular Weight | 623.90 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | tert-butyl 4-[4-[[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]-3-(3,6-dihydro-2H-thiopyran-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(NC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3CC=CCS3)c2)CC1 |
| InChI | InChI=1S/C32H45N5O4SSi/c1-32(2,3)41-31(39)36-14-12-23(13-15-36)24-10-11-27(26(19-24)28-9-7-8-17-42-28)35-30(38)29-34-25(20-33)21-37(29)22-40-16-18-43(4,5)6/h7-8,10-11,19,21,23,28H,9,12-18,22H2,1-6H3,(H,35,38) |
| InChIKey | UIHCLSVRIJSPPN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.90 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|