C33H47N5O4Si — CID 90858212
tert-butyl 4-[4-[[4-cyano-5-(2-trimethylsilylethoxymethyl)-1H-imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 90858212) has the molecular formula C33H47N5O4Si and a molecular weight of 605.86 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-cyano-5-(2-trimethylsilylethoxymethyl)-1H-imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[4-cyano-5-(2-trimethylsilylethoxymethyl)-1H-imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90858212 |
| Molecular Formula | C33H47N5O4Si |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | tert-butyl 4-[4-[[4-cyano-5-(2-trimethylsilylethoxymethyl)-1H-imidazole-2-carbonyl]amino]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(NC(=O)c3nc(C#N)c(COCC[Si](C)(C)C)[nH]3)c(C3=CCCCC3)c2)CC1 |
| InChI | InChI=1S/C33H47N5O4Si/c1-33(2,3)42-32(40)38-16-14-23(15-17-38)25-12-13-27(26(20-25)24-10-8-7-9-11-24)37-31(39)30-35-28(21-34)29(36-30)22-41-18-19-43(4,5)6/h10,12-13,20,23H,7-9,11,14-19,22H2,1-6H3,(H,35,36)(H,37,39) |
| InChIKey | GLSVSGYTUFNYRE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|