C30H40F3N5O4Si — CID 160858228
5-cyano-N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 160858228) has the molecular formula C30H40F3N5O4Si and a molecular weight of 619.76 g/mol. Its IUPAC name is 5-cyano-N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-cyano-N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160858228 |
| Molecular Formula | C30H40F3N5O4Si |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 5-cyano-N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C[Si](C)(C)CCOCn1c(C#N)cnc1C(=O)Nc1ccc(C2CCNCC2)cc1C1=CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H39N5O2Si.C2HF3O2/c1-36(2,3)16-15-35-20-33-24(18-29)19-31-27(33)28(34)32-26-10-9-23(21-11-13-30-14-12-21)17-25(26)22-7-5-4-6-8-22;3-2(4,5)1(6)7/h7,9-10,17,19,21,30H,4-6,8,11-16,20H2,1-3H3,(H,32,34);(H,6,7) |
| InChIKey | SKDKAJARVFWYLI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|