C23H26N4O2 — CID 122698803
(4-cyano-1H-pyrrol-2-yl) N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]carbamate (PubChem CID 122698803) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (4-cyano-1H-pyrrol-2-yl) N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]carbamate.
| Compound Name | (4-cyano-1H-pyrrol-2-yl) N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]carbamate |
|---|---|
| PubChem CID | 122698803 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (4-cyano-1H-pyrrol-2-yl) N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]carbamate |
| SMILES | N#Cc1c[nH]c(OC(=O)Nc2ccc(C3CCNCC3)cc2C2=CCCCC2)c1 |
| InChI | InChI=1S/C23H26N4O2/c24-14-16-12-22(26-15-16)29-23(28)27-21-7-6-19(17-8-10-25-11-9-17)13-20(21)18-4-2-1-3-5-18/h4,6-7,12-13,15,17,25-26H,1-3,5,8-11H2,(H,27,28) |
| InChIKey | CLNMLNINOSEJOA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |