C21H26F6N2O4 — CID 172783438
2-(cyclohexen-1-yl)-4-piperidin-4-ylaniline;bis(2,2,2-trifluoroacetic acid) (PubChem CID 172783438) has the molecular formula C21H26F6N2O4 and a molecular weight of 484.44 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-piperidin-4-ylaniline;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(cyclohexen-1-yl)-4-piperidin-4-ylaniline;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 172783438 |
| Molecular Formula | C21H26F6N2O4 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-piperidin-4-ylaniline;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Nc1ccc(C2CCNCC2)cc1C1=CCCCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N2.2C2HF3O2/c18-17-7-6-15(13-8-10-19-11-9-13)12-16(17)14-4-2-1-3-5-14;2*3-2(4,5)1(6)7/h4,6-7,12-13,19H,1-3,5,8-11,18H2;2*(H,6,7) |
| InChIKey | OOLRRWINURSLRG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|