C24H28F3N3O2 — CID 68500079
2-(cyclohexen-1-yl)-4-(1-pyridin-2-ylpiperidin-4-yl)aniline;2,2,2-trifluoroacetic acid (PubChem CID 68500079) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-4-(1-pyridin-2-ylpiperidin-4-yl)aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(cyclohexen-1-yl)-4-(1-pyridin-2-ylpiperidin-4-yl)aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68500079 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-(cyclohexen-1-yl)-4-(1-pyridin-2-ylpiperidin-4-yl)aniline;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccc(C2CCN(c3ccccn3)CC2)cc1C1=CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N3.C2HF3O2/c23-21-10-9-19(16-20(21)18-6-2-1-3-7-18)17-11-14-25(15-12-17)22-8-4-5-13-24-22;3-2(4,5)1(6)7/h4-6,8-10,13,16-17H,1-3,7,11-12,14-15,23H2;(H,6,7) |
| InChIKey | HWZBGTXTRHUZHL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|