C26H30F3N3O3 — CID 68505735
1-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]-2-pyridin-3-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 68505735) has the molecular formula C26H30F3N3O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is 1-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]-2-pyridin-3-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]-2-pyridin-3-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68505735 |
| Molecular Formula | C26H30F3N3O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 1-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]-2-pyridin-3-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccc(C2CCN(C(=O)Cc3cccnc3)CC2)cc1C1=CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H29N3O.C2HF3O2/c25-23-9-8-21(16-22(23)20-6-2-1-3-7-20)19-10-13-27(14-11-19)24(28)15-18-5-4-12-26-17-18;3-2(4,5)1(6)7/h4-6,8-9,12,16-17,19H,1-3,7,10-11,13-15,25H2;(H,6,7) |
| InChIKey | MDDXFEQKVISYBW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|