C24H25F6N5O3 — CID 157062816
N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1H-1,2,4-triazole-5-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157062816) has the molecular formula C24H25F6N5O3 and a molecular weight of 545.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1H-1,2,4-triazole-5-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1H-1,2,4-triazole-5-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157062816 |
| Molecular Formula | C24H25F6N5O3 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]-1H-1,2,4-triazole-5-carboxamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=C(Nc1ccc(C2CCNCC2)cc1C1=CCCCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C20H25N5O.C4F6O2/c26-20(19-22-13-23-25-19)24-18-7-6-16(14-8-10-21-11-9-14)12-17(18)15-4-2-1-3-5-15;5-3(6,7)1(11)2(12)4(8,9)10/h4,6-7,12-14,21H,1-3,5,8-11H2,(H,24,26)(H,22,23,25); |
| InChIKey | ABNGBNORIKADFX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|