C23H27N5O3 — CID 143568050
N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-(methylamino)-1H-imidazole-2-carboxamide (PubChem CID 143568050) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-(methylamino)-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-(methylamino)-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 143568050 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)-4-(1-methyl-2,6-dioxopiperidin-4-yl)phenyl]-5-(methylamino)-1H-imidazole-2-carboxamide |
| SMILES | CNc1cnc(C(=O)Nc2ccc(C3CC(=O)N(C)C(=O)C3)cc2C2=CCCCC2)[nH]1 |
| InChI | InChI=1S/C23H27N5O3/c1-24-19-13-25-22(27-19)23(31)26-18-9-8-15(10-17(18)14-6-4-3-5-7-14)16-11-20(29)28(2)21(30)12-16/h6,8-10,13,16,24H,3-5,7,11-12H2,1-2H3,(H,25,27)(H,26,31) |
| InChIKey | RECJJFVQYXEVOE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|