C27H35N4O4SSi — CID 143800967
CID 143800967 (PubChem CID 143800967) has the molecular formula C27H35N4O4SSi and a molecular weight of 539.75 g/mol.
| Compound Name | CID 143800967 |
|---|---|
| PubChem CID | 143800967 |
| Molecular Formula | C27H35N4O4SSi |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | — |
| SMILES | C[Si](C)CCOCn1cc(C#N)nc1C(=O)Nc1ccc(C2CCS(=O)(=O)CC2)cc1C1=CCCCC1 |
| InChI | InChI=1S/C27H35N4O4SSi/c1-37(2)15-12-35-19-31-18-23(17-28)29-26(31)27(32)30-25-9-8-22(20-10-13-36(33,34)14-11-20)16-24(25)21-6-4-3-5-7-21/h6,8-9,16,18,20H,3-5,7,10-15,19H2,1-2H3,(H,30,32) |
| InChIKey | VIFVDTKZAFQCAX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|