C34H48N4O4Si — CID 160559957
tert-butyl 4-[4-[2-[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-oxoethyl]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate (PubChem CID 160559957) has the molecular formula C34H48N4O4Si and a molecular weight of 604.87 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-oxoethyl]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-oxoethyl]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160559957 |
| Molecular Formula | C34H48N4O4Si |
| Molecular Weight | 604.87 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | tert-butyl 4-[4-[2-[4-cyano-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-oxoethyl]-3-(cyclohexen-1-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(CC(=O)c3nc(C#N)cn3COCC[Si](C)(C)C)c(C3=CCCCC3)c2)CC1 |
| InChI | InChI=1S/C34H48N4O4Si/c1-34(2,3)42-33(40)37-16-14-25(15-17-37)27-12-13-28(30(20-27)26-10-8-7-9-11-26)21-31(39)32-36-29(22-35)23-38(32)24-41-18-19-43(4,5)6/h10,12-13,20,23,25H,7-9,11,14-19,21,24H2,1-6H3 |
| InChIKey | LCUNBPKPESAWPT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.87 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|