C22H29N5O2Si — CID 58754861
4-cyano-N-[2-(cyclohexen-1-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide (PubChem CID 58754861) has the molecular formula C22H29N5O2Si and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-cyano-N-[2-(cyclohexen-1-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(cyclohexen-1-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58754861 |
| Molecular Formula | C22H29N5O2Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-cyano-N-[2-(cyclohexen-1-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Nc1cccnc1C1=CCCCC1 |
| InChI | InChI=1S/C22H29N5O2Si/c1-30(2,3)13-12-29-16-27-15-18(14-23)25-21(27)22(28)26-19-10-7-11-24-20(19)17-8-5-4-6-9-17/h7-8,10-11,15H,4-6,9,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | GYWZTWZTWYVAEB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|