C27H36N8O2Si — CID 58754822
4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2H-tetrazol-5-ylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide (PubChem CID 58754822) has the molecular formula C27H36N8O2Si and a molecular weight of 532.73 g/mol. Its IUPAC name is 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2H-tetrazol-5-ylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2H-tetrazol-5-ylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 58754822 |
| Molecular Formula | C27H36N8O2Si |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-4-(2H-tetrazol-5-ylmethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2cc(Cc3nn[nH]n3)ccc2NC(=O)c2nc(C#N)cn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C27H36N8O2Si/c1-27(2)10-8-20(9-11-27)22-14-19(15-24-31-33-34-32-24)6-7-23(22)30-26(36)25-29-21(16-28)17-35(25)18-37-12-13-38(3,4)5/h6-8,14,17H,9-13,15,18H2,1-5H3,(H,30,36)(H,31,32,33,34) |
| InChIKey | FRRMLKIBAOOMMV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|