C17H13ClN2O — CID 58387155
5-chloro-2-ethoxy-6-(2-phenylethynyl)-1H-benzimidazole (PubChem CID 58387155) has the molecular formula C17H13ClN2O and a molecular weight of 296.76 g/mol. Its IUPAC name is 5-chloro-2-ethoxy-6-(2-phenylethynyl)-1H-benzimidazole.
| Compound Name | 5-chloro-2-ethoxy-6-(2-phenylethynyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 58387155 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-chloro-2-ethoxy-6-(2-phenylethynyl)-1H-benzimidazole |
| SMILES | CCOc1nc2cc(Cl)c(C#Cc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C17H13ClN2O/c1-2-21-17-19-15-10-13(14(18)11-16(15)20-17)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2H2,1H3,(H,19,20) |
| InChIKey | KMPRSAOXJAJFPA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|