C18H13ClN2O3S — CID 67339140
2-[[5-chloro-6-[2-(4-methoxyphenyl)ethynyl]-1H-benzimidazol-2-yl]sulfanyl]acetic acid (PubChem CID 67339140) has the molecular formula C18H13ClN2O3S and a molecular weight of 372.83 g/mol. Its IUPAC name is 2-[[5-chloro-6-[2-(4-methoxyphenyl)ethynyl]-1H-benzimidazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-chloro-6-[2-(4-methoxyphenyl)ethynyl]-1H-benzimidazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 67339140 |
| Molecular Formula | C18H13ClN2O3S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2-[[5-chloro-6-[2-(4-methoxyphenyl)ethynyl]-1H-benzimidazol-2-yl]sulfanyl]acetic acid |
| SMILES | COc1ccc(C#Cc2cc3[nH]c(SCC(=O)O)nc3cc2Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O3S/c1-24-13-6-3-11(4-7-13)2-5-12-8-15-16(9-14(12)19)21-18(20-15)25-10-17(22)23/h3-4,6-9H,10H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | UYDUDGVYRDFLNZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|