C27H31N5O3 — CID 58387816
2-[2-[3-(2,6-dimethylanilino)imidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethoxymethyl]phenoxy]acetamide (PubChem CID 58387816) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[2-[3-(2,6-dimethylanilino)imidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethoxymethyl]phenoxy]acetamide.
| Compound Name | 2-[2-[3-(2,6-dimethylanilino)imidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethoxymethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 58387816 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-[2-[3-(2,6-dimethylanilino)imidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethoxymethyl]phenoxy]acetamide |
| SMILES | CNCCOCc1cccc(OCC(N)=O)c1-c1nc2ccccn2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C27H31N5O3/c1-18-8-6-9-19(2)25(18)31-27-26(30-23-12-4-5-14-32(23)27)24-20(16-34-15-13-29-3)10-7-11-21(24)35-17-22(28)33/h4-12,14,29,31H,13,15-17H2,1-3H3,(H2,28,33) |
| InChIKey | DCVBCDFONWDENC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|