C26H29FN6O2 — CID 67350656
2-[2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethylamino]phenoxy]acetamide (PubChem CID 67350656) has the molecular formula C26H29FN6O2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethylamino]phenoxy]acetamide.
| Compound Name | 2-[2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 67350656 |
| Molecular Formula | C26H29FN6O2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-[2-(methylamino)ethylamino]phenoxy]acetamide |
| SMILES | CNCCNc1cccc(OCC(N)=O)c1-c1nc2ccc(F)cn2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C26H29FN6O2/c1-16-6-4-7-17(2)24(16)32-26-25(31-22-11-10-18(27)14-33(22)26)23-19(30-13-12-29-3)8-5-9-20(23)35-15-21(28)34/h4-11,14,29-30,32H,12-13,15H2,1-3H3,(H2,28,34) |
| InChIKey | ZPLKGEUBDBEJPK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|