C23H22FN5O2 — CID 24854757
2-[4-amino-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]phenoxy]acetamide (PubChem CID 24854757) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-[4-amino-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]phenoxy]acetamide.
| Compound Name | 2-[4-amino-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 24854757 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-amino-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]phenoxy]acetamide |
| SMILES | Cc1cccc(C)c1Nc1c(-c2cc(N)ccc2OCC(N)=O)nc2ccc(F)cn12 |
| InChI | InChI=1S/C23H22FN5O2/c1-13-4-3-5-14(2)21(13)28-23-22(27-20-9-6-15(24)11-29(20)23)17-10-16(25)7-8-18(17)31-12-19(26)30/h3-11,28H,12,25H2,1-2H3,(H2,26,30) |
| InChIKey | ZKUNELBBWJIKOK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|