C27H28FN5O4 — CID 87365965
2-[5-(1-amino-2-oxoethoxy)-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-ethylphenoxy]acetamide (PubChem CID 87365965) has the molecular formula C27H28FN5O4 and a molecular weight of 505.55 g/mol. Its IUPAC name is 2-[5-(1-amino-2-oxoethoxy)-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-ethylphenoxy]acetamide.
| Compound Name | 2-[5-(1-amino-2-oxoethoxy)-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-ethylphenoxy]acetamide |
|---|---|
| PubChem CID | 87365965 |
| Molecular Formula | C27H28FN5O4 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 2-[5-(1-amino-2-oxoethoxy)-2-[3-(2,6-dimethylanilino)-6-fluoroimidazo[1,2-a]pyridin-2-yl]-3-ethylphenoxy]acetamide |
| SMILES | CCc1cc(OC(N)C=O)cc(OCC(N)=O)c1-c1nc2ccc(F)cn2c1Nc1c(C)cccc1C |
| InChI | InChI=1S/C27H28FN5O4/c1-4-17-10-19(37-22(30)13-34)11-20(36-14-21(29)35)24(17)26-27(32-25-15(2)6-5-7-16(25)3)33-12-18(28)8-9-23(33)31-26/h5-13,22,32H,4,14,30H2,1-3H3,(H2,29,35) |
| InChIKey | JFDQFTCSWVWFHB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|