C24H22FN5O5 — CID 67352744
2-[2-[6-fluoro-3-(2-methyl-6-nitroanilino)imidazo[1,2-a]pyridin-2-yl]-5-methoxy-3-methylphenoxy]acetamide (PubChem CID 67352744) has the molecular formula C24H22FN5O5 and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-[2-[6-fluoro-3-(2-methyl-6-nitroanilino)imidazo[1,2-a]pyridin-2-yl]-5-methoxy-3-methylphenoxy]acetamide.
| Compound Name | 2-[2-[6-fluoro-3-(2-methyl-6-nitroanilino)imidazo[1,2-a]pyridin-2-yl]-5-methoxy-3-methylphenoxy]acetamide |
|---|---|
| PubChem CID | 67352744 |
| Molecular Formula | C24H22FN5O5 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[2-[6-fluoro-3-(2-methyl-6-nitroanilino)imidazo[1,2-a]pyridin-2-yl]-5-methoxy-3-methylphenoxy]acetamide |
| SMILES | COc1cc(C)c(-c2nc3ccc(F)cn3c2Nc2c(C)cccc2[N+](=O)[O-])c(OCC(N)=O)c1 |
| InChI | InChI=1S/C24H22FN5O5/c1-13-5-4-6-17(30(32)33)22(13)28-24-23(27-20-8-7-15(25)11-29(20)24)21-14(2)9-16(34-3)10-18(21)35-12-19(26)31/h4-11,28H,12H2,1-3H3,(H2,26,31) |
| InChIKey | GHFFJHWSQZYFFV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|