C27H26F3N3O7S — CID 58388961
2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 58388961) has the molecular formula C27H26F3N3O7S and a molecular weight of 593.58 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58388961 |
| Molecular Formula | C27H26F3N3O7S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-4-[[4-[[4-(trifluoromethylsulfonyl)piperazin-1-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(OCc4ccc(CN5CCN(S(=O)(=O)C(F)(F)F)CC5)cc4)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C27H26F3N3O7S/c28-27(29,30)41(38,39)32-12-10-31(11-13-32)15-17-4-6-18(7-5-17)16-40-23-3-1-2-20-24(23)26(37)33(25(20)36)21-9-8-19(34)14-22(21)35/h1-7,21H,8-16H2 |
| InChIKey | VECGUBUWDHJIKJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|