C35H31N5O2 — CID 58389418
CID 58389418 (PubChem CID 58389418) has the molecular formula C35H31N5O2 and a molecular weight of 553.67 g/mol.
| Compound Name | CID 58389418 |
|---|---|
| PubChem CID | 58389418 |
| Molecular Formula | C35H31N5O2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)C1(C=Nc3cc4c(cc3O1)N(C)C1(C=Nc3c(ccc5ccccc35)O1)C4(C)C)N2C |
| InChI | InChI=1S/C35H31N5O2/c1-32(2)24-16-22(36-5)13-14-27(24)39(6)34(32)19-37-26-17-25-28(18-30(26)42-34)40(7)35(33(25,3)4)20-38-31-23-11-9-8-10-21(23)12-15-29(31)41-35/h8-20H,1-4,6-7H3 |
| InChIKey | HDAZLLZVLMSXHW-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|