C20H37N3O2 — CID 58390551
tert-butyl 3-[3,5,7-tris(aminomethyl)-1-adamantyl]propanoate (PubChem CID 58390551) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is tert-butyl 3-[3,5,7-tris(aminomethyl)-1-adamantyl]propanoate.
| Compound Name | tert-butyl 3-[3,5,7-tris(aminomethyl)-1-adamantyl]propanoate |
|---|---|
| PubChem CID | 58390551 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | tert-butyl 3-[3,5,7-tris(aminomethyl)-1-adamantyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC12CC3(CN)CC(CN)(CC(CN)(C3)C1)C2 |
| InChI | InChI=1S/C20H37N3O2/c1-16(2,3)25-15(24)4-5-17-6-18(12-21)9-19(7-17,13-22)11-20(8-17,10-18)14-23/h4-14,21-23H2,1-3H3 |
| InChIKey | GIOAFFQKAIHBGP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |