C24H28Cl2FN5O — CID 58393600
N'-[(1S,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-fluorophenoxy]-2,3-dihydro-1H-inden-2-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 58393600) has the molecular formula C24H28Cl2FN5O and a molecular weight of 492.43 g/mol. Its IUPAC name is N'-[(1S,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-fluorophenoxy]-2,3-dihydro-1H-inden-2-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(1S,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-fluorophenoxy]-2,3-dihydro-1H-inden-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 58393600 |
| Molecular Formula | C24H28Cl2FN5O |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N'-[(1S,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2-fluorophenoxy]-2,3-dihydro-1H-inden-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | Cc1nnc(C)n1-c1ccc(O[C@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N(C)CCN(C)C)c(F)c1 |
| InChI | InChI=1S/C24H28Cl2FN5O/c1-14-28-29-15(2)32(14)17-6-7-23(21(27)12-17)33-24-19-10-16(25)11-20(26)18(19)13-22(24)31(5)9-8-30(3)4/h6-7,10-12,22,24H,8-9,13H2,1-5H3/t22-,24-/m0/s1 |
| InChIKey | SRFRGOWIWSMXHD-UPVQGACJSA-N |
| XLogP | 4.87 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |