C22H25FN2O — CID 58393920
(3aR,6aS)-5-[(1R,2R)-1-(4-fluoro-2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 58393920) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (3aR,6aS)-5-[(1R,2R)-1-(4-fluoro-2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[(1R,2R)-1-(4-fluoro-2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 58393920 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (3aR,6aS)-5-[(1R,2R)-1-(4-fluoro-2-methylphenoxy)-2,3-dihydro-1H-inden-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Cc1cc(F)ccc1O[C@@H]1c2ccccc2C[C@H]1N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C22H25FN2O/c1-14-8-18(23)6-7-21(14)26-22-19-5-3-2-4-15(19)9-20(22)25-12-16-10-24-11-17(16)13-25/h2-8,16-17,20,22,24H,9-13H2,1H3/t16-,17+,20-,22-/m1/s1 |
| InChIKey | HCSRLKFLPPFNEL-IMLKGASGSA-N |
| XLogP | 3.33 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |