C21H26N6O — CID 58394909
3-[4-[4-(oxolan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidin-1-yl]butanenitrile (PubChem CID 58394909) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[4-[4-(oxolan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidin-1-yl]butanenitrile.
| Compound Name | 3-[4-[4-(oxolan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 58394909 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[4-[4-(oxolan-3-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]piperidin-1-yl]butanenitrile |
| SMILES | CC(CC#N)N1CCC(n2c(C3CCOC3)nc3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-14(2-7-22)26-9-4-16(5-10-26)27-19-17-3-8-23-20(17)24-12-18(19)25-21(27)15-6-11-28-13-15/h3,8,12,14-16H,2,4-6,9-11,13H2,1H3,(H,23,24) |
| InChIKey | PPPQKSXAWXJERQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |