C26H29F2N7O — CID 58395548
1-(4,4-difluoropiperidin-1-yl)-2-[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanone (PubChem CID 58395548) has the molecular formula C26H29F2N7O and a molecular weight of 493.56 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-2-[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanone.
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-2-[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanone |
|---|---|
| PubChem CID | 58395548 |
| Molecular Formula | C26H29F2N7O |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-2-[3-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanone |
| SMILES | O=C(Cc1nc2cnc3[nH]ccc3c2n1C1CCN(Cc2cccnc2)CC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C26H29F2N7O/c27-26(28)6-12-34(13-7-26)23(36)14-22-32-21-16-31-25-20(3-9-30-25)24(21)35(22)19-4-10-33(11-5-19)17-18-2-1-8-29-15-18/h1-3,8-9,15-16,19H,4-7,10-14,17H2,(H,30,31) |
| InChIKey | WFVDYQYPIGOCGU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |