C21H24BrN3OSi — CID 58395902
2-[[4-bromo-2-(3H-isoindol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 58395902) has the molecular formula C21H24BrN3OSi and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[[4-bromo-2-(3H-isoindol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-2-(3H-isoindol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58395902 |
| Molecular Formula | C21H24BrN3OSi |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[[4-bromo-2-(3H-isoindol-5-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc3c(c2)CN=C3)cc2c(Br)ccnc21 |
| InChI | InChI=1S/C21H24BrN3OSi/c1-27(2,3)9-8-26-14-25-20(11-18-19(22)6-7-24-21(18)25)15-4-5-16-12-23-13-17(16)10-15/h4-7,10-12H,8-9,13-14H2,1-3H3 |
| InChIKey | HVVSBQWTBWORGK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|