C31H35N7O2 — CID 58396305
1-ethyl-3-[3-methyl-4-[[3-[2-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]urea (PubChem CID 58396305) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 1-ethyl-3-[3-methyl-4-[[3-[2-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]urea.
| Compound Name | 1-ethyl-3-[3-methyl-4-[[3-[2-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 58396305 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 1-ethyl-3-[3-methyl-4-[[3-[2-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]pyrimidin-4-yl]-2-pyridinyl]oxy]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(Oc2ncccc2-c2ccnc(Cc3ccc(N4CCN(C)CC4)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C31H35N7O2/c1-4-32-31(39)35-24-9-12-28(22(2)20-24)40-30-26(6-5-14-34-30)27-13-15-33-29(36-27)21-23-7-10-25(11-8-23)38-18-16-37(3)17-19-38/h5-15,20H,4,16-19,21H2,1-3H3,(H2,32,35,39) |
| InChIKey | MRAZYFAQYWFYQG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|